C11H22N2O4S — CID 136541403
6-(2-methoxyethylsulfonyl)-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 136541403) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is 6-(2-methoxyethylsulfonyl)-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | 6-(2-methoxyethylsulfonyl)-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 136541403 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 6-(2-methoxyethylsulfonyl)-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | COCCS(=O)(=O)N1CCC2OCCN(C)C2C1 |
| InChI | InChI=1S/C11H22N2O4S/c1-12-5-6-17-11-3-4-13(9-10(11)12)18(14,15)8-7-16-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | JZMZLCIVECUAMF-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |