C10H17NO7S — CID 112562206
1-(2-methoxyethylsulfonyl)piperidine-3,4-dicarboxylic acid (PubChem CID 112562206) has the molecular formula C10H17NO7S and a molecular weight of 295.31 g/mol. Its IUPAC name is 1-(2-methoxyethylsulfonyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(2-methoxyethylsulfonyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 112562206 |
| Molecular Formula | C10H17NO7S |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-(2-methoxyethylsulfonyl)piperidine-3,4-dicarboxylic acid |
| SMILES | COCCS(=O)(=O)N1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C10H17NO7S/c1-18-4-5-19(16,17)11-3-2-7(9(12)13)8(6-11)10(14)15/h7-8H,2-6H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | MKIDKIKMKVYNAP-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |