C9H17NO5S — CID 104937263
1-(2-methoxyethylsulfonyl)-3-methylpyrrolidine-2-carboxylic acid (PubChem CID 104937263) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is 1-(2-methoxyethylsulfonyl)-3-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-methoxyethylsulfonyl)-3-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 104937263 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(2-methoxyethylsulfonyl)-3-methylpyrrolidine-2-carboxylic acid |
| SMILES | COCCS(=O)(=O)N1CCC(C)C1C(=O)O |
| InChI | InChI=1S/C9H17NO5S/c1-7-3-4-10(8(7)9(11)12)16(13,14)6-5-15-2/h7-8H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | BWBIQBVYOSDDAW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |