C12H23NO6S — CID 122105158
(2S,3S)-1-[2-(2-methoxyethoxy)ethylsulfonyl]-2-methylpiperidine-3-carboxylic acid (PubChem CID 122105158) has the molecular formula C12H23NO6S and a molecular weight of 309.38 g/mol. Its IUPAC name is (2S,3S)-1-[2-(2-methoxyethoxy)ethylsulfonyl]-2-methylpiperidine-3-carboxylic acid.
| Compound Name | (2S,3S)-1-[2-(2-methoxyethoxy)ethylsulfonyl]-2-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105158 |
| Molecular Formula | C12H23NO6S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2S,3S)-1-[2-(2-methoxyethoxy)ethylsulfonyl]-2-methylpiperidine-3-carboxylic acid |
| SMILES | COCCOCCS(=O)(=O)N1CCC[C@H](C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C12H23NO6S/c1-10-11(12(14)15)4-3-5-13(10)20(16,17)9-8-19-7-6-18-2/h10-11H,3-9H2,1-2H3,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | OQOOTIKCHPLOOE-QWRGUYRKSA-N |
| XLogP | 0.16 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|