C9H14F3NO5S — CID 122069617
(2R)-1-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]pyrrolidine-2-carboxylic acid (PubChem CID 122069617) has the molecular formula C9H14F3NO5S and a molecular weight of 305.27 g/mol. Its IUPAC name is (2R)-1-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122069617 |
| Molecular Formula | C9H14F3NO5S |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (2R)-1-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1S(=O)(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO5S/c10-9(11,12)6-18-4-5-19(16,17)13-3-1-2-7(13)8(14)15/h7H,1-6H2,(H,14,15)/t7-/m1/s1 |
| InChIKey | DNRQDHWGGFHKPX-SSDOTTSWSA-N |
| XLogP | 0.44 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|