C11H18F3NO5S — CID 95313558
2-(2,2,2-trifluoroethoxy)ethyl (2S)-1-methylsulfonylpiperidine-2-carboxylate (PubChem CID 95313558) has the molecular formula C11H18F3NO5S and a molecular weight of 333.33 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)ethyl (2S)-1-methylsulfonylpiperidine-2-carboxylate.
| Compound Name | 2-(2,2,2-trifluoroethoxy)ethyl (2S)-1-methylsulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 95313558 |
| Molecular Formula | C11H18F3NO5S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)ethyl (2S)-1-methylsulfonylpiperidine-2-carboxylate |
| SMILES | CS(=O)(=O)N1CCCC[C@H]1C(=O)OCCOCC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO5S/c1-21(17,18)15-5-3-2-4-9(15)10(16)20-7-6-19-8-11(12,13)14/h9H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | ZOWHRJPTLXNSRJ-VIFPVBQESA-N |
| XLogP | 0.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|