C13H20F3NO4 — CID 78991952
ethyl 1-[3-(2,2,2-trifluoroethoxy)propanoyl]piperidine-2-carboxylate (PubChem CID 78991952) has the molecular formula C13H20F3NO4 and a molecular weight of 311.30 g/mol. Its IUPAC name is ethyl 1-[3-(2,2,2-trifluoroethoxy)propanoyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[3-(2,2,2-trifluoroethoxy)propanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 78991952 |
| Molecular Formula | C13H20F3NO4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethyl 1-[3-(2,2,2-trifluoroethoxy)propanoyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C13H20F3NO4/c1-2-21-12(19)10-5-3-4-7-17(10)11(18)6-8-20-9-13(14,15)16/h10H,2-9H2,1H3 |
| InChIKey | VQPSXWXYBMBZKC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|