C15H25F3N2O2 — CID 129430447
1-[(2R)-2-[(2S)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 129430447) has the molecular formula C15H25F3N2O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-[(2R)-2-[(2S)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-[(2R)-2-[(2S)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 129430447 |
| Molecular Formula | C15H25F3N2O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[(2R)-2-[(2S)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | CCN1CCC[C@H]1[C@H]1CCCN1C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C15H25F3N2O2/c1-2-19-8-3-5-12(19)13-6-4-9-20(13)14(21)7-10-22-11-15(16,17)18/h12-13H,2-11H2,1H3/t12-,13+/m0/s1 |
| InChIKey | UROMSLGJOVMDFK-QWHCGFSZSA-N |
| XLogP | 2.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|