C9H15F3N2O4S — CID 81343242
1-methylsulfonyl-N-(2,2,2-trifluoroethoxy)piperidine-3-carboxamide (PubChem CID 81343242) has the molecular formula C9H15F3N2O4S and a molecular weight of 304.29 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(2,2,2-trifluoroethoxy)piperidine-3-carboxamide.
| Compound Name | 1-methylsulfonyl-N-(2,2,2-trifluoroethoxy)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81343242 |
| Molecular Formula | C9H15F3N2O4S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-methylsulfonyl-N-(2,2,2-trifluoroethoxy)piperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)NOCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O4S/c1-19(16,17)14-4-2-3-7(5-14)8(15)13-18-6-9(10,11)12/h7H,2-6H2,1H3,(H,13,15) |
| InChIKey | VGTHDINDBLLDOV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|