C11H20N2O5S — CID 60729585
methyl 3-[(1-methylsulfonylpiperidine-3-carbonyl)amino]propanoate (PubChem CID 60729585) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is methyl 3-[(1-methylsulfonylpiperidine-3-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[(1-methylsulfonylpiperidine-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 60729585 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 3-[(1-methylsulfonylpiperidine-3-carbonyl)amino]propanoate |
| SMILES | COC(=O)CCNC(=O)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H20N2O5S/c1-18-10(14)5-6-12-11(15)9-4-3-7-13(8-9)19(2,16)17/h9H,3-8H2,1-2H3,(H,12,15) |
| InChIKey | JFALRMDMUGCVLO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |