C14H26N2O4S — CID 115362212
N-[[1-(hydroxymethyl)cyclopentyl]methyl]-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 115362212) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclopentyl]methyl]-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 115362212 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)NCC2(CO)CCCC2)C1 |
| InChI | InChI=1S/C14H26N2O4S/c1-21(19,20)16-8-4-5-12(9-16)13(18)15-10-14(11-17)6-2-3-7-14/h12,17H,2-11H2,1H3,(H,15,18) |
| InChIKey | NXRQOSCWQUOWSJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |