C10H20N2O4S — CID 2992280
N-(2-methoxyethyl)-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 2992280) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 2992280 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(2-methoxyethyl)-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H20N2O4S/c1-16-7-5-11-10(13)9-4-3-6-12(8-9)17(2,14)15/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | YTOQYJZMEZCGOU-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|