C17H25N3O5S — CID 132657722
N-[2-(2-methoxyethylcarbamoyl)phenyl]-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 132657722) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[2-(2-methoxyethylcarbamoyl)phenyl]-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-(2-methoxyethylcarbamoyl)phenyl]-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 132657722 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[2-(2-methoxyethylcarbamoyl)phenyl]-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=O)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C17H25N3O5S/c1-25-11-9-18-17(22)14-7-3-4-8-15(14)19-16(21)13-6-5-10-20(12-13)26(2,23)24/h3-4,7-8,13H,5-6,9-12H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | NYBLHCFYKKAXTE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|