C19H29N3O5S — CID 125042744
(3S)-1-ethylsulfonyl-N-[2-(3-methoxypropylcarbamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 125042744) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is (3S)-1-ethylsulfonyl-N-[2-(3-methoxypropylcarbamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-ethylsulfonyl-N-[2-(3-methoxypropylcarbamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125042744 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (3S)-1-ethylsulfonyl-N-[2-(3-methoxypropylcarbamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@H](C(=O)Nc2ccccc2C(=O)NCCCOC)C1 |
| InChI | InChI=1S/C19H29N3O5S/c1-3-28(25,26)22-12-6-8-15(14-22)18(23)21-17-10-5-4-9-16(17)19(24)20-11-7-13-27-2/h4-5,9-10,15H,3,6-8,11-14H2,1-2H3,(H,20,24)(H,21,23)/t15-/m0/s1 |
| InChIKey | JABCIXQTFDDPRZ-HNNXBMFYSA-N |
| XLogP | 1.45 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|