C16H23N3O4S — CID 95875581
(3R)-N-(3-carbamoyl-2-methylphenyl)-1-ethylsulfonylpiperidine-3-carboxamide (PubChem CID 95875581) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is (3R)-N-(3-carbamoyl-2-methylphenyl)-1-ethylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-(3-carbamoyl-2-methylphenyl)-1-ethylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 95875581 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (3R)-N-(3-carbamoyl-2-methylphenyl)-1-ethylsulfonylpiperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@@H](C(=O)Nc2cccc(C(N)=O)c2C)C1 |
| InChI | InChI=1S/C16H23N3O4S/c1-3-24(22,23)19-9-5-6-12(10-19)16(21)18-14-8-4-7-13(11(14)2)15(17)20/h4,7-8,12H,3,5-6,9-10H2,1-2H3,(H2,17,20)(H,18,21)/t12-/m1/s1 |
| InChIKey | LEUPELFKXPVXNJ-GFCCVEGCSA-N |
| XLogP | 1.09 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |