C21H25N3O4S — CID 46461883
1-(benzenesulfonyl)-N-[2-methyl-3-(methylcarbamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 46461883) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-methyl-3-(methylcarbamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-methyl-3-(methylcarbamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46461883 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-methyl-3-(methylcarbamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C2CCCN(S(=O)(=O)c3ccccc3)C2)c1C |
| InChI | InChI=1S/C21H25N3O4S/c1-15-18(21(26)22-2)11-6-12-19(15)23-20(25)16-8-7-13-24(14-16)29(27,28)17-9-4-3-5-10-17/h3-6,9-12,16H,7-8,13-14H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | IMWZTJJPWLKSOK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |