C27H29N3O4S — CID 133167756
1-(benzenesulfonyl)-N-[2-(1-phenylethylcarbamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 133167756) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(1-phenylethylcarbamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(1-phenylethylcarbamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133167756 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(1-phenylethylcarbamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)C1CCCN(S(=O)(=O)c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-20(21-11-4-2-5-12-21)28-27(32)24-16-8-9-17-25(24)29-26(31)22-13-10-18-30(19-22)35(33,34)23-14-6-3-7-15-23/h2-9,11-12,14-17,20,22H,10,13,18-19H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | UASDZXVRXCYWIO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |