C22H27N3O2 — CID 99970141
(3R)-1-methyl-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]piperidine-3-carboxamide (PubChem CID 99970141) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (3R)-1-methyl-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-methyl-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 99970141 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (3R)-1-methyl-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]piperidine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1NC(=O)[C@@H]1CCCN(C)C1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O2/c1-16(17-9-4-3-5-10-17)23-22(27)19-12-6-7-13-20(19)24-21(26)18-11-8-14-25(2)15-18/h3-7,9-10,12-13,16,18H,8,11,14-15H2,1-2H3,(H,23,27)(H,24,26)/t16-,18-/m1/s1 |
| InChIKey | IGFLEPVWCPSTCO-SJLPKXTDSA-N |
| XLogP | 3.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |