C27H28ClN3O4S — CID 133189446
1-(4-chlorophenyl)sulfonyl-N-[2-(2-phenylethylcarbamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 133189446) has the molecular formula C27H28ClN3O4S and a molecular weight of 526.06 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[2-(2-phenylethylcarbamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[2-(2-phenylethylcarbamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133189446 |
| Molecular Formula | C27H28ClN3O4S |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[2-(2-phenylethylcarbamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccccc1NC(=O)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C27H28ClN3O4S/c28-22-12-14-23(15-13-22)36(34,35)31-18-6-9-21(19-31)26(32)30-25-11-5-4-10-24(25)27(33)29-17-16-20-7-2-1-3-8-20/h1-5,7-8,10-15,21H,6,9,16-19H2,(H,29,33)(H,30,32) |
| InChIKey | DONURYOQEPEHIZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |