C25H30ClN3O4S — CID 133189442
1-(4-chlorophenyl)sulfonyl-N-[2-(cyclohexylcarbamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 133189442) has the molecular formula C25H30ClN3O4S and a molecular weight of 504.05 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[2-(cyclohexylcarbamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[2-(cyclohexylcarbamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133189442 |
| Molecular Formula | C25H30ClN3O4S |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[2-(cyclohexylcarbamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccccc1NC(=O)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H30ClN3O4S/c26-19-12-14-21(15-13-19)34(32,33)29-16-6-7-18(17-29)24(30)28-23-11-5-4-10-22(23)25(31)27-20-8-2-1-3-9-20/h4-5,10-15,18,20H,1-3,6-9,16-17H2,(H,27,31)(H,28,30) |
| InChIKey | JBHILZBHWNVEOB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |