C23H28ClN3O5S — CID 92642602
1-[(4-chlorophenyl)methylsulfonyl]-N-[2-(2-methoxyethylcarbamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 92642602) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methylsulfonyl]-N-[2-(2-methoxyethylcarbamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methylsulfonyl]-N-[2-(2-methoxyethylcarbamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92642602 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methylsulfonyl]-N-[2-(2-methoxyethylcarbamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=O)C1CCN(S(=O)(=O)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H28ClN3O5S/c1-32-15-12-25-23(29)20-4-2-3-5-21(20)26-22(28)18-10-13-27(14-11-18)33(30,31)16-17-6-8-19(24)9-7-17/h2-9,18H,10-16H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | UVAXKWBOCRQYSL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|