C14H28N2O5S — CID 55685553
N-[2-(2-methoxyethoxy)ethyl]-1-propylsulfonylpiperidine-3-carboxamide (PubChem CID 55685553) has the molecular formula C14H28N2O5S and a molecular weight of 336.45 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-1-propylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-1-propylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55685553 |
| Molecular Formula | C14H28N2O5S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-1-propylsulfonylpiperidine-3-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCC(C(=O)NCCOCCOC)C1 |
| InChI | InChI=1S/C14H28N2O5S/c1-3-11-22(18,19)16-7-4-5-13(12-16)14(17)15-6-8-21-10-9-20-2/h13H,3-12H2,1-2H3,(H,15,17) |
| InChIKey | ASDHUQBTKCXESK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|