C17H31N3O4S — CID 94101912
(3R)-N-(3-oxo-3-piperidin-1-ylpropyl)-1-propylsulfonylpiperidine-3-carboxamide (PubChem CID 94101912) has the molecular formula C17H31N3O4S and a molecular weight of 373.52 g/mol. Its IUPAC name is (3R)-N-(3-oxo-3-piperidin-1-ylpropyl)-1-propylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-(3-oxo-3-piperidin-1-ylpropyl)-1-propylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94101912 |
| Molecular Formula | C17H31N3O4S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (3R)-N-(3-oxo-3-piperidin-1-ylpropyl)-1-propylsulfonylpiperidine-3-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCC[C@@H](C(=O)NCCC(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C17H31N3O4S/c1-2-13-25(23,24)20-12-6-7-15(14-20)17(22)18-9-8-16(21)19-10-4-3-5-11-19/h15H,2-14H2,1H3,(H,18,22)/t15-/m1/s1 |
| InChIKey | YBYYRMXLBRTOTQ-OAHLLOKOSA-N |
| XLogP | 0.96 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |