C14H22N4O6S — CID 39034326
(3R)-N-(2-methoxyethyl)-1-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-3-carboxamide (PubChem CID 39034326) has the molecular formula C14H22N4O6S and a molecular weight of 374.42 g/mol. Its IUPAC name is (3R)-N-(2-methoxyethyl)-1-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(2-methoxyethyl)-1-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 39034326 |
| Molecular Formula | C14H22N4O6S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (3R)-N-(2-methoxyethyl)-1-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCCN(S(=O)(=O)c2c(C)[nH]c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C14H22N4O6S/c1-9-11(13(20)17-14(21)16-9)25(22,23)18-6-3-4-10(8-18)12(19)15-5-7-24-2/h10H,3-8H2,1-2H3,(H,15,19)(H2,16,17,20,21)/t10-/m1/s1 |
| InChIKey | ORNBLWYKECMIBX-SNVBAGLBSA-N |
| XLogP | -1.47 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|