C17H20N2O7S — CID 122068613
1-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethylsulfonyl]pyrrolidine-2-carboxylic acid (PubChem CID 122068613) has the molecular formula C17H20N2O7S and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethylsulfonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethylsulfonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122068613 |
| Molecular Formula | C17H20N2O7S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethylsulfonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1S(=O)(=O)CCOCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H20N2O7S/c20-15-12-4-1-2-5-13(12)16(21)18(15)8-9-26-10-11-27(24,25)19-7-3-6-14(19)17(22)23/h1-2,4-5,14H,3,6-11H2,(H,22,23) |
| InChIKey | XJLVYAJYNFNKAF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|