C16H18N2O4 — CID 82224049
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidine-2-carboxylic acid (PubChem CID 82224049) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 82224049 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18N2O4/c19-14-11-5-1-2-6-12(11)15(20)18(14)10-9-17-8-4-3-7-13(17)16(21)22/h1-2,5-6,13H,3-4,7-10H2,(H,21,22) |
| InChIKey | BGTAIGGHKKSZJG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|