C17H20N2O4 — CID 124613957
methyl 2-[(2R)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-2-yl]acetate (PubChem CID 124613957) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 2-[(2R)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 124613957 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl 2-[(2R)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCCN1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H20N2O4/c1-23-15(20)11-12-5-4-8-18(12)9-10-19-16(21)13-6-2-3-7-14(13)17(19)22/h2-3,6-7,12H,4-5,8-11H2,1H3/t12-/m1/s1 |
| InChIKey | CWJAXVAAJULCSU-GFCCVEGCSA-N |
| XLogP | 1.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|