C17H23N3O2 — CID 119926222
2-[2-[2-(aminomethyl)-3-methylpiperidin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 119926222) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[2-[2-(aminomethyl)-3-methylpiperidin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-(aminomethyl)-3-methylpiperidin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 119926222 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[2-[2-(aminomethyl)-3-methylpiperidin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC1CCCN(CCN2C(=O)c3ccccc3C2=O)C1CN |
| InChI | InChI=1S/C17H23N3O2/c1-12-5-4-8-19(15(12)11-18)9-10-20-16(21)13-6-2-3-7-14(13)17(20)22/h2-3,6-7,12,15H,4-5,8-11,18H2,1H3 |
| InChIKey | SEAKCROHNYRFAL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|