C16H17F3N2O3 — CID 95621723
2-[2-[(2S)-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 95621723) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2-[2-[(2S)-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S)-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 95621723 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[2-[(2S)-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCC[C@H]1[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O3/c17-16(18,19)13(22)12-6-3-7-20(12)8-9-21-14(23)10-4-1-2-5-11(10)15(21)24/h1-2,4-5,12-13,22H,3,6-9H2/t12-,13-/m0/s1 |
| InChIKey | UQGPXLBUCWQDMT-STQMWFEESA-N |
| XLogP | 1.67 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|