C20H21N3O5 — CID 7800277
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[(1S,2S)-2-methylcyclohexyl]imidazolidine-2,4,5-trione (PubChem CID 7800277) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[(1S,2S)-2-methylcyclohexyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[(1S,2S)-2-methylcyclohexyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7800277 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[(1S,2S)-2-methylcyclohexyl]imidazolidine-2,4,5-trione |
| SMILES | C[C@H]1CCCC[C@@H]1N1C(=O)C(=O)N(CCN2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C20H21N3O5/c1-12-6-2-5-9-15(12)23-19(27)18(26)22(20(23)28)11-10-21-16(24)13-7-3-4-8-14(13)17(21)25/h3-4,7-8,12,15H,2,5-6,9-11H2,1H3/t12-,15-/m0/s1 |
| InChIKey | DTVJOYQOOYHEIP-WFASDCNBSA-N |
| XLogP | 1.65 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|