C13H21N3O4 — CID 61363381
methyl 2-[1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]piperidin-2-yl]acetate (PubChem CID 61363381) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl 2-[1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 61363381 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | methyl 2-[1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1CCN1C(=O)CNC1=O |
| InChI | InChI=1S/C13H21N3O4/c1-20-12(18)8-10-4-2-3-5-15(10)6-7-16-11(17)9-14-13(16)19/h10H,2-9H2,1H3,(H,14,19) |
| InChIKey | LMXXFWPBZBYIHH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|