C16H32N2O2 — CID 106708111
methyl 2-[1-(6-amino-5,5-dimethylhexyl)piperidin-2-yl]acetate (PubChem CID 106708111) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is methyl 2-[1-(6-amino-5,5-dimethylhexyl)piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-(6-amino-5,5-dimethylhexyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 106708111 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | methyl 2-[1-(6-amino-5,5-dimethylhexyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1CCCCC(C)(C)CN |
| InChI | InChI=1S/C16H32N2O2/c1-16(2,13-17)9-5-7-11-18-10-6-4-8-14(18)12-15(19)20-3/h14H,4-13,17H2,1-3H3 |
| InChIKey | WZYPYBOUILRYKE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|