C11H21NO4 — CID 82851116
methyl 2-[1-(2,3-dihydroxypropyl)piperidin-2-yl]acetate (PubChem CID 82851116) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is methyl 2-[1-(2,3-dihydroxypropyl)piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-(2,3-dihydroxypropyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 82851116 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | methyl 2-[1-(2,3-dihydroxypropyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1CC(O)CO |
| InChI | InChI=1S/C11H21NO4/c1-16-11(15)6-9-4-2-3-5-12(9)7-10(14)8-13/h9-10,13-14H,2-8H2,1H3 |
| InChIKey | YRBULCMUTJKFJU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |