C12H23NO3 — CID 82851054
1-[1-(2,3-dihydroxypropyl)azepan-2-yl]propan-2-one (PubChem CID 82851054) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-[1-(2,3-dihydroxypropyl)azepan-2-yl]propan-2-one.
| Compound Name | 1-[1-(2,3-dihydroxypropyl)azepan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 82851054 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 1-[1-(2,3-dihydroxypropyl)azepan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCCCN1CC(O)CO |
| InChI | InChI=1S/C12H23NO3/c1-10(15)7-11-5-3-2-4-6-13(11)8-12(16)9-14/h11-12,14,16H,2-9H2,1H3 |
| InChIKey | XGFXRSUZBRKHKA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |