C10H21NO2 — CID 82850957
3-(2-methylazepan-1-yl)propane-1,2-diol (PubChem CID 82850957) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 3-(2-methylazepan-1-yl)propane-1,2-diol.
| Compound Name | 3-(2-methylazepan-1-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 82850957 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 3-(2-methylazepan-1-yl)propane-1,2-diol |
| SMILES | CC1CCCCCN1CC(O)CO |
| InChI | InChI=1S/C10H21NO2/c1-9-5-3-2-4-6-11(9)7-10(13)8-12/h9-10,12-13H,2-8H2,1H3 |
| InChIKey | WIGFSBHQAOBQMI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |