About ethanol;(2S)-1-ethyl-2-methylpiperidine
ethanol;(2S)-1-ethyl-2-methylpiperidine (PubChem CID 170618464) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is ethanol;(2S)-1-ethyl-2-methylpiperidine.
Molecular Properties
| Compound Name | ethanol;(2S)-1-ethyl-2-methylpiperidine |
| PubChem CID | 170618464 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | ethanol;(2S)-1-ethyl-2-methylpiperidine |
| SMILES | CCN1CCCC[C@@H]1C.CCO |
| InChI | InChI=1S/C8H17N.C2H6O/c1-3-9-7-5-4-6-8(9)2;1-2-3/h8H,3-7H2,1-2H3;3H,2H2,1H3/t8-;/m0./s1 |
| InChIKey | PFFIRWDFWYUPIC-QRPNPIFTSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;(2S)-1-ethyl-2-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;(2S)-1-ethyl-2-methylpiperidine?
The IUPAC name of ethanol;(2S)-1-ethyl-2-methylpiperidine (CID 170618464) is ethanol;(2S)-1-ethyl-2-methylpiperidine.
What is the SMILES notation for ethanol;(2S)-1-ethyl-2-methylpiperidine?
The canonical SMILES for ethanol;(2S)-1-ethyl-2-methylpiperidine is CCN1CCCC[C@@H]1C.CCO.
What is the InChIKey of ethanol;(2S)-1-ethyl-2-methylpiperidine?
The InChIKey is PFFIRWDFWYUPIC-QRPNPIFTSA-N. The full InChI is InChI=1S/C8H17N.C2H6O/c1-3-9-7-5-4-6-8(9)2;1-2-3/h8H,3-7H2,1-2H3;3H,2H2,1H3/t8-;/m0./s1.
What are the key properties of ethanol;(2S)-1-ethyl-2-methylpiperidine?
ethanol;(2S)-1-ethyl-2-methylpiperidine has a molecular weight of 173.30 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;(2S)-1-ethyl-2-methylpiperidine is sourced from PubChem (CID 170618464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).