methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate

C17H25NO2 — CID 62026011

IUPACmethyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate
SMILESCOC(=O)CC1CCCCN1Cc1cc(C)cc(C)c1
InChIInChI=1S/C17H25NO2/c1-13-8-14(2)10-15(9-13)12-18-7-5-4-6-16(18)11-17(19)20-3/h8-10,16H,4-7,11-12H2,1-3H3
InChIKeyNZWRYABPCJKSGL-UHFFFAOYSA-N
MW275.39 g/mol
LogP3.22
Rot. Bonds4

About methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate

methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate (PubChem CID 62026011) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate
PubChem CID62026011
Molecular FormulaC17H25NO2
Molecular Weight275.39 g/mol
Exact Mass275.19
IUPAC Namemethyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate
SMILESCOC(=O)CC1CCCCN1Cc1cc(C)cc(C)c1
InChIInChI=1S/C17H25NO2/c1-13-8-14(2)10-15(9-13)12-18-7-5-4-6-16(18)11-17(19)20-3/h8-10,16H,4-7,11-12H2,1-3H3
InChIKeyNZWRYABPCJKSGL-UHFFFAOYSA-N
XLogP3.22
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.39
LogP ≤ 53.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate?
The IUPAC name of methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate (CID 62026011) is methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate.
What is the SMILES notation for methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate?
The canonical SMILES for methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate is COC(=O)CC1CCCCN1Cc1cc(C)cc(C)c1.
What is the InChIKey of methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate?
The InChIKey is NZWRYABPCJKSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-13-8-14(2)10-15(9-13)12-18-7-5-4-6-16(18)11-17(19)20-3/h8-10,16H,4-7,11-12H2,1-3H3.
What are the key properties of methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate?
methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate has a molecular weight of 275.39 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(3,5-dimethylphenyl)methyl]piperidin-2-yl]acetate is sourced from PubChem (CID 62026011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).