C15H19F2NO2 — CID 78969714
methyl 2-[1-[(3,4-difluorophenyl)methyl]piperidin-2-yl]acetate (PubChem CID 78969714) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is methyl 2-[1-[(3,4-difluorophenyl)methyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-[(3,4-difluorophenyl)methyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 78969714 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl 2-[1-[(3,4-difluorophenyl)methyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H19F2NO2/c1-20-15(19)9-12-4-2-3-7-18(12)10-11-5-6-13(16)14(17)8-11/h5-6,8,12H,2-4,7,9-10H2,1H3 |
| InChIKey | WEBZNMFTGMAYAH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |