C15H18BrF2NO2 — CID 106270339
methyl 2-[1-[(3-bromo-2,6-difluorophenyl)methyl]piperidin-2-yl]acetate (PubChem CID 106270339) has the molecular formula C15H18BrF2NO2 and a molecular weight of 362.21 g/mol. Its IUPAC name is methyl 2-[1-[(3-bromo-2,6-difluorophenyl)methyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-[(3-bromo-2,6-difluorophenyl)methyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 106270339 |
| Molecular Formula | C15H18BrF2NO2 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | methyl 2-[1-[(3-bromo-2,6-difluorophenyl)methyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H18BrF2NO2/c1-21-14(20)8-10-4-2-3-7-19(10)9-11-13(17)6-5-12(16)15(11)18/h5-6,10H,2-4,7-9H2,1H3 |
| InChIKey | SZVLUJMZMMPFSB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|