C14H16BrF2NO3 — CID 106270408
methyl 2-[4-[(3-bromo-2,6-difluorophenyl)methyl]morpholin-2-yl]acetate (PubChem CID 106270408) has the molecular formula C14H16BrF2NO3 and a molecular weight of 364.19 g/mol. Its IUPAC name is methyl 2-[4-[(3-bromo-2,6-difluorophenyl)methyl]morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-[(3-bromo-2,6-difluorophenyl)methyl]morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 106270408 |
| Molecular Formula | C14H16BrF2NO3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | methyl 2-[4-[(3-bromo-2,6-difluorophenyl)methyl]morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(Cc2c(F)ccc(Br)c2F)CCO1 |
| InChI | InChI=1S/C14H16BrF2NO3/c1-20-13(19)6-9-7-18(4-5-21-9)8-10-12(16)3-2-11(15)14(10)17/h2-3,9H,4-8H2,1H3 |
| InChIKey | NFTYGIVXWAVIPQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|