C15H17FN2O3 — CID 103886154
methyl 2-[4-[(3-cyano-2-fluorophenyl)methyl]morpholin-2-yl]acetate (PubChem CID 103886154) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is methyl 2-[4-[(3-cyano-2-fluorophenyl)methyl]morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-[(3-cyano-2-fluorophenyl)methyl]morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 103886154 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | methyl 2-[4-[(3-cyano-2-fluorophenyl)methyl]morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(Cc2cccc(C#N)c2F)CCO1 |
| InChI | InChI=1S/C15H17FN2O3/c1-20-14(19)7-13-10-18(5-6-21-13)9-12-4-2-3-11(8-17)15(12)16/h2-4,13H,5-7,9-10H2,1H3 |
| InChIKey | FNSWEGPYMCPAND-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |