C17H19FN2O3 — CID 96999157
methyl 2-[(2S)-4-[(6-fluoroquinolin-8-yl)methyl]morpholin-2-yl]acetate (PubChem CID 96999157) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is methyl 2-[(2S)-4-[(6-fluoroquinolin-8-yl)methyl]morpholin-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-4-[(6-fluoroquinolin-8-yl)methyl]morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 96999157 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl 2-[(2S)-4-[(6-fluoroquinolin-8-yl)methyl]morpholin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1CN(Cc2cc(F)cc3cccnc23)CCO1 |
| InChI | InChI=1S/C17H19FN2O3/c1-22-16(21)9-15-11-20(5-6-23-15)10-13-8-14(18)7-12-3-2-4-19-17(12)13/h2-4,7-8,15H,5-6,9-11H2,1H3/t15-/m0/s1 |
| InChIKey | DLJPTFIZZPCTFE-HNNXBMFYSA-N |
| XLogP | 2.14 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |