C13H16Cl2N2O3 — CID 104969525
methyl 2-[4-[(2,6-dichloro-3-pyridinyl)methyl]morpholin-2-yl]acetate (PubChem CID 104969525) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is methyl 2-[4-[(2,6-dichloro-3-pyridinyl)methyl]morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-[(2,6-dichloro-3-pyridinyl)methyl]morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 104969525 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | methyl 2-[4-[(2,6-dichloro-3-pyridinyl)methyl]morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(Cc2ccc(Cl)nc2Cl)CCO1 |
| InChI | InChI=1S/C13H16Cl2N2O3/c1-19-12(18)6-10-8-17(4-5-20-10)7-9-2-3-11(14)16-13(9)15/h2-3,10H,4-8H2,1H3 |
| InChIKey | VWFPADVQCCJAOU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|