C16H20N2O3 — CID 114485245
methyl 2-[4-[(4-cyano-2-methylphenyl)methyl]morpholin-2-yl]acetate (PubChem CID 114485245) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl 2-[4-[(4-cyano-2-methylphenyl)methyl]morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-[(4-cyano-2-methylphenyl)methyl]morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 114485245 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | methyl 2-[4-[(4-cyano-2-methylphenyl)methyl]morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(Cc2ccc(C#N)cc2C)CCO1 |
| InChI | InChI=1S/C16H20N2O3/c1-12-7-13(9-17)3-4-14(12)10-18-5-6-21-15(11-18)8-16(19)20-2/h3-4,7,15H,5-6,8,10-11H2,1-2H3 |
| InChIKey | RCFNGGSIDBRFOZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |