C16H22BrNO3 — CID 65327147
methyl 2-[1-[(2-bromo-5-methoxyphenyl)methyl]piperidin-2-yl]acetate (PubChem CID 65327147) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is methyl 2-[1-[(2-bromo-5-methoxyphenyl)methyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-[(2-bromo-5-methoxyphenyl)methyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 65327147 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | methyl 2-[1-[(2-bromo-5-methoxyphenyl)methyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1Cc1cc(OC)ccc1Br |
| InChI | InChI=1S/C16H22BrNO3/c1-20-14-6-7-15(17)12(9-14)11-18-8-4-3-5-13(18)10-16(19)21-2/h6-7,9,13H,3-5,8,10-11H2,1-2H3 |
| InChIKey | NGUYZYJALNCQEZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |