C16H26BrN3O2 — CID 144568176
ethane;methyl 2-[1-[(2-amino-5-bromo-3-pyridinyl)methyl]piperidin-2-yl]acetate (PubChem CID 144568176) has the molecular formula C16H26BrN3O2 and a molecular weight of 372.31 g/mol. Its IUPAC name is ethane;methyl 2-[1-[(2-amino-5-bromo-3-pyridinyl)methyl]piperidin-2-yl]acetate.
| Compound Name | ethane;methyl 2-[1-[(2-amino-5-bromo-3-pyridinyl)methyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 144568176 |
| Molecular Formula | C16H26BrN3O2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethane;methyl 2-[1-[(2-amino-5-bromo-3-pyridinyl)methyl]piperidin-2-yl]acetate |
| SMILES | CC.COC(=O)CC1CCCCN1Cc1cc(Br)cnc1N |
| InChI | InChI=1S/C14H20BrN3O2.C2H6/c1-20-13(19)7-12-4-2-3-5-18(12)9-10-6-11(15)8-17-14(10)16;1-2/h6,8,12H,2-5,7,9H2,1H3,(H2,16,17);1-2H3 |
| InChIKey | DBWODBBPCPYBND-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |