methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate

C16H21NO4 — CID 62028859

IUPACmethyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate
SMILESCOC(=O)CC1CCCCN1Cc1ccc2c(c1)OCO2
InChIInChI=1S/C16H21NO4/c1-19-16(18)9-13-4-2-3-7-17(13)10-12-5-6-14-15(8-12)21-11-20-14/h5-6,8,13H,2-4,7,9-11H2,1H3
InChIKeyMPYUOBKPZPELST-UHFFFAOYSA-N
MW291.35 g/mol
LogP2.33
Rot. Bonds4

About methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate

methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate (PubChem CID 62028859) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate
PubChem CID62028859
Molecular FormulaC16H21NO4
Molecular Weight291.35 g/mol
Exact Mass291.15
IUPAC Namemethyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate
SMILESCOC(=O)CC1CCCCN1Cc1ccc2c(c1)OCO2
InChIInChI=1S/C16H21NO4/c1-19-16(18)9-13-4-2-3-7-17(13)10-12-5-6-14-15(8-12)21-11-20-14/h5-6,8,13H,2-4,7,9-11H2,1H3
InChIKeyMPYUOBKPZPELST-UHFFFAOYSA-N
XLogP2.33
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate?
The IUPAC name of methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate (CID 62028859) is methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate.
What is the SMILES notation for methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate?
The canonical SMILES for methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate is COC(=O)CC1CCCCN1Cc1ccc2c(c1)OCO2.
What is the InChIKey of methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate?
The InChIKey is MPYUOBKPZPELST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-19-16(18)9-13-4-2-3-7-17(13)10-12-5-6-14-15(8-12)21-11-20-14/h5-6,8,13H,2-4,7,9-11H2,1H3.
What are the key properties of methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate?
methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate has a molecular weight of 291.35 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-2-yl]acetate is sourced from PubChem (CID 62028859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).