C12H13NO4 — CID 139239851
methyl (2S)-1-(1,3-benzodioxol-5-ylmethyl)aziridine-2-carboxylate (PubChem CID 139239851) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl (2S)-1-(1,3-benzodioxol-5-ylmethyl)aziridine-2-carboxylate.
| Compound Name | methyl (2S)-1-(1,3-benzodioxol-5-ylmethyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 139239851 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl (2S)-1-(1,3-benzodioxol-5-ylmethyl)aziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CN1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H13NO4/c1-15-12(14)9-6-13(9)5-8-2-3-10-11(4-8)17-7-16-10/h2-4,9H,5-7H2,1H3/t9-,13?/m0/s1 |
| InChIKey | UWUQKJGGTXJCHF-LLTODGECSA-N |
| XLogP | 0.77 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|