C15H18N2O4S2 — CID 9053878
methyl (2R)-4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)thiomorpholine-2-carboxylate (PubChem CID 9053878) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl (2R)-4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)thiomorpholine-2-carboxylate.
| Compound Name | methyl (2R)-4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9053878 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | methyl (2R)-4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)thiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=S)NCc2ccc3c(c2)OCO3)CCS1 |
| InChI | InChI=1S/C15H18N2O4S2/c1-19-14(18)13-8-17(4-5-23-13)15(22)16-7-10-2-3-11-12(6-10)21-9-20-11/h2-3,6,13H,4-5,7-9H2,1H3,(H,16,22)/t13-/m1/s1 |
| InChIKey | UKHKWYPJGFAQKD-CYBMUJFWSA-N |
| XLogP | 1.38 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|