C20H20F2N2O4S — CID 3866777
N-(1,3-benzodioxol-5-ylmethyl)-2-[(2,5-difluorophenoxy)methyl]morpholine-4-carbothioamide (PubChem CID 3866777) has the molecular formula C20H20F2N2O4S and a molecular weight of 422.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(2,5-difluorophenoxy)methyl]morpholine-4-carbothioamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(2,5-difluorophenoxy)methyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3866777 |
| Molecular Formula | C20H20F2N2O4S |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(2,5-difluorophenoxy)methyl]morpholine-4-carbothioamide |
| SMILES | Fc1ccc(F)c(OCC2CN(C(=S)NCc3ccc4c(c3)OCO4)CCO2)c1 |
| InChI | InChI=1S/C20H20F2N2O4S/c21-14-2-3-16(22)18(8-14)26-11-15-10-24(5-6-25-15)20(29)23-9-13-1-4-17-19(7-13)28-12-27-17/h1-4,7-8,15H,5-6,9-12H2,(H,23,29) |
| InChIKey | YSDOJEHTRVXDBR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|